C29H32N6O2 — CID 138748160
7-[2-[(3aR,6R,6aS)-6-(4-aminopyrrolo[2,3-d]pyrimidin-7-yl)-2,2-dimethyl-6,6a-dihydro-3aH-cyclopenta[d][1,3]dioxol-4-yl]ethyl]-N-cyclobutylquinolin-2-amine (PubChem CID 138748160) has the molecular formula C29H32N6O2 and a molecular weight of 496.62 g/mol. Its IUPAC name is 7-[2-[(3aR,6R,6aS)-6-(4-aminopyrrolo[2,3-d]pyrimidin-7-yl)-2,2-dimethyl-6,6a-dihydro-3aH-cyclopenta[d][1,3]dioxol-4-yl]ethyl]-N-cyclobutylquinolin-2-amine.
| Compound Name | 7-[2-[(3aR,6R,6aS)-6-(4-aminopyrrolo[2,3-d]pyrimidin-7-yl)-2,2-dimethyl-6,6a-dihydro-3aH-cyclopenta[d][1,3]dioxol-4-yl]ethyl]-N-cyclobutylquinolin-2-amine |
|---|---|
| PubChem CID | 138748160 |
| Molecular Formula | C29H32N6O2 |
| Molecular Weight | 496.62 g/mol |
| Exact Mass | 496.26 |
| IUPAC Name | 7-[2-[(3aR,6R,6aS)-6-(4-aminopyrrolo[2,3-d]pyrimidin-7-yl)-2,2-dimethyl-6,6a-dihydro-3aH-cyclopenta[d][1,3]dioxol-4-yl]ethyl]-N-cyclobutylquinolin-2-amine |
| SMILES | CC1(C)O[C@@H]2[C@H](O1)C(CCc1ccc3ccc(NC4CCC4)nc3c1)=C[C@H]2n1ccc2c(N)ncnc21 |
| InChI | InChI=1S/C29H32N6O2/c1-29(2)36-25-19(15-23(26(25)37-29)35-13-12-21-27(30)31-16-32-28(21)35)9-7-17-6-8-18-10-11-24(34-22(18)14-17)33-20-4-3-5-20/h6,8,10-16,20,23,25-26H,3-5,7,9H2,1-2H3,(H,33,34)(H2,30,31,32)/t23-,25-,26+/m1/s1 |
| InChIKey | DTFWDBYXQNRDPW-ARMFNRFLSA-N |
| XLogP | 5.16 |
| TPSA | 100.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.62 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|