About 7-[1-(4-aminopyrrolo[2,3-d]pyrimidin-7-yl)ethyl]-N-cyclobutylquinolin-2-amine
7-[1-(4-aminopyrrolo[2,3-d]pyrimidin-7-yl)ethyl]-N-cyclobutylquinolin-2-amine (PubChem CID 175381939) has the molecular formula C21H22N6
and a molecular weight of 358.45 g/mol. Its IUPAC name is 7-[1-(4-aminopyrrolo[2,3-d]pyrimidin-7-yl)ethyl]-N-cyclobutylquinolin-2-amine.
Molecular Properties
| Compound Name | 7-[1-(4-aminopyrrolo[2,3-d]pyrimidin-7-yl)ethyl]-N-cyclobutylquinolin-2-amine |
| PubChem CID | 175381939 |
| Molecular Formula | C21H22N6 |
| Molecular Weight | 358.45 g/mol |
| Exact Mass | 358.19 |
| IUPAC Name | 7-[1-(4-aminopyrrolo[2,3-d]pyrimidin-7-yl)ethyl]-N-cyclobutylquinolin-2-amine |
| SMILES | CC(c1ccc2ccc(NC3CCC3)nc2c1)n1ccc2c(N)ncnc21 |
| InChI | InChI=1S/C21H22N6/c1-13(27-10-9-17-20(22)23-12-24-21(17)27)15-6-5-14-7-8-19(26-18(14)11-15)25-16-3-2-4-16/h5-13,16H,2-4H2,1H3,(H,25,26)(H2,22,23,24) |
| InChIKey | HEVQQESDDQNRSQ-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 81.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 358.45 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 7-[1-(4-aminopyrrolo[2,3-d]pyrimidin-7-yl)ethyl]-N-cyclobutylquinolin-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-[1-(4-aminopyrrolo[2,3-d]pyrimidin-7-yl)ethyl]-N-cyclobutylquinolin-2-amine?
The IUPAC name of 7-[1-(4-aminopyrrolo[2,3-d]pyrimidin-7-yl)ethyl]-N-cyclobutylquinolin-2-amine (CID 175381939) is 7-[1-(4-aminopyrrolo[2,3-d]pyrimidin-7-yl)ethyl]-N-cyclobutylquinolin-2-amine.
What is the SMILES notation for 7-[1-(4-aminopyrrolo[2,3-d]pyrimidin-7-yl)ethyl]-N-cyclobutylquinolin-2-amine?
The canonical SMILES for 7-[1-(4-aminopyrrolo[2,3-d]pyrimidin-7-yl)ethyl]-N-cyclobutylquinolin-2-amine is CC(c1ccc2ccc(NC3CCC3)nc2c1)n1ccc2c(N)ncnc21.
What is the InChIKey of 7-[1-(4-aminopyrrolo[2,3-d]pyrimidin-7-yl)ethyl]-N-cyclobutylquinolin-2-amine?
The InChIKey is HEVQQESDDQNRSQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H22N6/c1-13(27-10-9-17-20(22)23-12-24-21(17)27)15-6-5-14-7-8-19(26-18(14)11-15)25-16-3-2-4-16/h5-13,16H,2-4H2,1H3,(H,25,26)(H2,22,23,24).
What are the key properties of 7-[1-(4-aminopyrrolo[2,3-d]pyrimidin-7-yl)ethyl]-N-cyclobutylquinolin-2-amine?
7-[1-(4-aminopyrrolo[2,3-d]pyrimidin-7-yl)ethyl]-N-cyclobutylquinolin-2-amine has a molecular weight of 358.45 g/mol, XLogP of 4.14, 4 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 7-[1-(4-aminopyrrolo[2,3-d]pyrimidin-7-yl)ethyl]-N-cyclobutylquinolin-2-amine is sourced from PubChem (CID 175381939), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).