C23H24N6O3 — CID 175486942
(1R)-5-(4-aminopyrrolo[2,3-d]pyrimidin-7-yl)-3-[1-[2-(methylamino)quinolin-7-yl]oxyethyl]cyclopent-3-ene-1,2-diol (PubChem CID 175486942) has the molecular formula C23H24N6O3 and a molecular weight of 432.48 g/mol. Its IUPAC name is (1R)-5-(4-aminopyrrolo[2,3-d]pyrimidin-7-yl)-3-[1-[2-(methylamino)quinolin-7-yl]oxyethyl]cyclopent-3-ene-1,2-diol.
| Compound Name | (1R)-5-(4-aminopyrrolo[2,3-d]pyrimidin-7-yl)-3-[1-[2-(methylamino)quinolin-7-yl]oxyethyl]cyclopent-3-ene-1,2-diol |
|---|---|
| PubChem CID | 175486942 |
| Molecular Formula | C23H24N6O3 |
| Molecular Weight | 432.48 g/mol |
| Exact Mass | 432.19 |
| IUPAC Name | (1R)-5-(4-aminopyrrolo[2,3-d]pyrimidin-7-yl)-3-[1-[2-(methylamino)quinolin-7-yl]oxyethyl]cyclopent-3-ene-1,2-diol |
| SMILES | CNc1ccc2ccc(OC(C)C3=CC(n4ccc5c(N)ncnc54)[C@@H](O)C3O)cc2n1 |
| InChI | InChI=1S/C23H24N6O3/c1-12(32-14-5-3-13-4-6-19(25-2)28-17(13)9-14)16-10-18(21(31)20(16)30)29-8-7-15-22(24)26-11-27-23(15)29/h3-12,18,20-21,30-31H,1-2H3,(H,25,28)(H2,24,26,27)/t12?,18?,20?,21-/m1/s1 |
| InChIKey | GYQCFNXGWVMZMB-IRLZMHCVSA-N |
| XLogP | 2.27 |
| TPSA | 131.34 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.48 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|