C29H36ClN5O2 — CID 145263938
7-[2-[3-(4-chloropyrrolo[2,3-d]pyrimidin-7-yl)cyclopentyl]ethyl]-N-cyclobutylquinolin-2-amine;propane-2,2-diol (PubChem CID 145263938) has the molecular formula C29H36ClN5O2 and a molecular weight of 522.09 g/mol. Its IUPAC name is 7-[2-[3-(4-chloropyrrolo[2,3-d]pyrimidin-7-yl)cyclopentyl]ethyl]-N-cyclobutylquinolin-2-amine;propane-2,2-diol.
| Compound Name | 7-[2-[3-(4-chloropyrrolo[2,3-d]pyrimidin-7-yl)cyclopentyl]ethyl]-N-cyclobutylquinolin-2-amine;propane-2,2-diol |
|---|---|
| PubChem CID | 145263938 |
| Molecular Formula | C29H36ClN5O2 |
| Molecular Weight | 522.09 g/mol |
| Exact Mass | 521.26 |
| IUPAC Name | 7-[2-[3-(4-chloropyrrolo[2,3-d]pyrimidin-7-yl)cyclopentyl]ethyl]-N-cyclobutylquinolin-2-amine;propane-2,2-diol |
| SMILES | CC(C)(O)O.Clc1ncnc2c1ccn2C1CCC(CCc2ccc3ccc(NC4CCC4)nc3c2)C1 |
| InChI | InChI=1S/C26H28ClN5.C3H8O2/c27-25-22-12-13-32(26(22)29-16-28-25)21-10-7-17(14-21)4-5-18-6-8-19-9-11-24(31-23(19)15-18)30-20-2-1-3-20;1-3(2,4)5/h6,8-9,11-13,15-17,20-21H,1-5,7,10,14H2,(H,30,31);4-5H,1-2H3 |
| InChIKey | WDZJNQOOZBPPMV-UHFFFAOYSA-N |
| XLogP | 6.28 |
| TPSA | 96.09 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.09 |
| LogP ≤ 5 | 6.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|