C25H26ClN5O3 — CID 126637574
(2R,3R,4S,5R)-2-(4-chloropyrrolo[2,3-d]pyrimidin-7-yl)-5-[2-[2-(cyclopropylmethylamino)quinolin-7-yl]ethyl]oxolane-3,4-diol (PubChem CID 126637574) has the molecular formula C25H26ClN5O3 and a molecular weight of 479.97 g/mol. Its IUPAC name is (2R,3R,4S,5R)-2-(4-chloropyrrolo[2,3-d]pyrimidin-7-yl)-5-[2-[2-(cyclopropylmethylamino)quinolin-7-yl]ethyl]oxolane-3,4-diol.
| Compound Name | (2R,3R,4S,5R)-2-(4-chloropyrrolo[2,3-d]pyrimidin-7-yl)-5-[2-[2-(cyclopropylmethylamino)quinolin-7-yl]ethyl]oxolane-3,4-diol |
|---|---|
| PubChem CID | 126637574 |
| Molecular Formula | C25H26ClN5O3 |
| Molecular Weight | 479.97 g/mol |
| Exact Mass | 479.17 |
| IUPAC Name | (2R,3R,4S,5R)-2-(4-chloropyrrolo[2,3-d]pyrimidin-7-yl)-5-[2-[2-(cyclopropylmethylamino)quinolin-7-yl]ethyl]oxolane-3,4-diol |
| SMILES | O[C@@H]1[C@H](O)[C@@H](CCc2ccc3ccc(NCC4CC4)nc3c2)O[C@H]1n1ccc2c(Cl)ncnc21 |
| InChI | InChI=1S/C25H26ClN5O3/c26-23-17-9-10-31(24(17)29-13-28-23)25-22(33)21(32)19(34-25)7-4-14-3-5-16-6-8-20(30-18(16)11-14)27-12-15-1-2-15/h3,5-6,8-11,13,15,19,21-22,25,32-33H,1-2,4,7,12H2,(H,27,30)/t19-,21-,22-,25-/m1/s1 |
| InChIKey | KVKFNEYWJUDSHS-PTGPVQHPSA-N |
| XLogP | 3.71 |
| TPSA | 105.32 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.97 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |