C24H23N5O3 — CID 164951864
(2R,3R,4S,5R)-2-(4-aminopyrrolo[2,3-d]pyrimidin-7-yl)-5-[2-(3H-cyclopenta[b]quinolin-6-yl)ethyl]oxolane-3,4-diol (PubChem CID 164951864) has the molecular formula C24H23N5O3 and a molecular weight of 429.48 g/mol. Its IUPAC name is (2R,3R,4S,5R)-2-(4-aminopyrrolo[2,3-d]pyrimidin-7-yl)-5-[2-(3H-cyclopenta[b]quinolin-6-yl)ethyl]oxolane-3,4-diol.
| Compound Name | (2R,3R,4S,5R)-2-(4-aminopyrrolo[2,3-d]pyrimidin-7-yl)-5-[2-(3H-cyclopenta[b]quinolin-6-yl)ethyl]oxolane-3,4-diol |
|---|---|
| PubChem CID | 164951864 |
| Molecular Formula | C24H23N5O3 |
| Molecular Weight | 429.48 g/mol |
| Exact Mass | 429.18 |
| IUPAC Name | (2R,3R,4S,5R)-2-(4-aminopyrrolo[2,3-d]pyrimidin-7-yl)-5-[2-(3H-cyclopenta[b]quinolin-6-yl)ethyl]oxolane-3,4-diol |
| SMILES | Nc1ncnc2c1ccn2[C@@H]1O[C@H](CCc2ccc3cc4c(nc3c2)CC=C4)[C@@H](O)[C@H]1O |
| InChI | InChI=1S/C24H23N5O3/c25-22-16-8-9-29(23(16)27-12-26-22)24-21(31)20(30)19(32-24)7-5-13-4-6-15-11-14-2-1-3-17(14)28-18(15)10-13/h1-2,4,6,8-12,19-21,24,30-31H,3,5,7H2,(H2,25,26,27)/t19-,20-,21-,24-/m1/s1 |
| InChIKey | QWNUITFGCQNFDI-GECPAALWSA-N |
| XLogP | 2.38 |
| TPSA | 119.31 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.48 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |