C26H29F2N5O2 — CID 155399524
7-[(3aR,6R,6aS)-4-[2-[5-(difluoromethyl)-1,2,3,4-tetrahydroisoquinolin-8-yl]ethyl]-2,2-dimethyl-6,6a-dihydro-3aH-cyclopenta[d][1,3]dioxol-6-yl]pyrrolo[2,3-d]pyrimidin-4-amine (PubChem CID 155399524) has the molecular formula C26H29F2N5O2 and a molecular weight of 481.55 g/mol. Its IUPAC name is 7-[(3aR,6R,6aS)-4-[2-[5-(difluoromethyl)-1,2,3,4-tetrahydroisoquinolin-8-yl]ethyl]-2,2-dimethyl-6,6a-dihydro-3aH-cyclopenta[d][1,3]dioxol-6-yl]pyrrolo[2,3-d]pyrimidin-4-amine.
| Compound Name | 7-[(3aR,6R,6aS)-4-[2-[5-(difluoromethyl)-1,2,3,4-tetrahydroisoquinolin-8-yl]ethyl]-2,2-dimethyl-6,6a-dihydro-3aH-cyclopenta[d][1,3]dioxol-6-yl]pyrrolo[2,3-d]pyrimidin-4-amine |
|---|---|
| PubChem CID | 155399524 |
| Molecular Formula | C26H29F2N5O2 |
| Molecular Weight | 481.55 g/mol |
| Exact Mass | 481.23 |
| IUPAC Name | 7-[(3aR,6R,6aS)-4-[2-[5-(difluoromethyl)-1,2,3,4-tetrahydroisoquinolin-8-yl]ethyl]-2,2-dimethyl-6,6a-dihydro-3aH-cyclopenta[d][1,3]dioxol-6-yl]pyrrolo[2,3-d]pyrimidin-4-amine |
| SMILES | CC1(C)O[C@@H]2[C@H](O1)C(CCc1ccc(C(F)F)c3c1CNCC3)=C[C@H]2n1ccc2c(N)ncnc21 |
| InChI | InChI=1S/C26H29F2N5O2/c1-26(2)34-21-15(4-3-14-5-6-17(23(27)28)16-7-9-30-12-19(14)16)11-20(22(21)35-26)33-10-8-18-24(29)31-13-32-25(18)33/h5-6,8,10-11,13,20-23,30H,3-4,7,9,12H2,1-2H3,(H2,29,31,32)/t20-,21-,22+/m1/s1 |
| InChIKey | FSFFTSHKVLGYFP-VSKRKVRLSA-N |
| XLogP | 4.23 |
| TPSA | 87.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.55 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|