C23H24F3N5O2 — CID 175573669
(1R)-5-(4-aminopyrrolo[2,3-d]pyrimidin-7-yl)-3-[2-[6-(difluoromethyl)-5-fluoro-1,2,3,4-tetrahydroisoquinolin-8-yl]ethyl]cyclopent-3-ene-1,2-diol (PubChem CID 175573669) has the molecular formula C23H24F3N5O2 and a molecular weight of 459.47 g/mol. Its IUPAC name is (1R)-5-(4-aminopyrrolo[2,3-d]pyrimidin-7-yl)-3-[2-[6-(difluoromethyl)-5-fluoro-1,2,3,4-tetrahydroisoquinolin-8-yl]ethyl]cyclopent-3-ene-1,2-diol.
| Compound Name | (1R)-5-(4-aminopyrrolo[2,3-d]pyrimidin-7-yl)-3-[2-[6-(difluoromethyl)-5-fluoro-1,2,3,4-tetrahydroisoquinolin-8-yl]ethyl]cyclopent-3-ene-1,2-diol |
|---|---|
| PubChem CID | 175573669 |
| Molecular Formula | C23H24F3N5O2 |
| Molecular Weight | 459.47 g/mol |
| Exact Mass | 459.19 |
| IUPAC Name | (1R)-5-(4-aminopyrrolo[2,3-d]pyrimidin-7-yl)-3-[2-[6-(difluoromethyl)-5-fluoro-1,2,3,4-tetrahydroisoquinolin-8-yl]ethyl]cyclopent-3-ene-1,2-diol |
| SMILES | Nc1ncnc2c1ccn2C1C=C(CCc2cc(C(F)F)c(F)c3c2CNCC3)C(O)[C@@H]1O |
| InChI | InChI=1S/C23H24F3N5O2/c24-18-13-3-5-28-9-16(13)11(7-15(18)21(25)26)1-2-12-8-17(20(33)19(12)32)31-6-4-14-22(27)29-10-30-23(14)31/h4,6-8,10,17,19-21,28,32-33H,1-3,5,9H2,(H2,27,29,30)/t17?,19?,20-/m1/s1 |
| InChIKey | ZRUOVSUXUMEUGT-LYBXBRPPSA-N |
| XLogP | 2.57 |
| TPSA | 109.22 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.47 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|