C24H26F3N5O2 — CID 175573675
(1R)-5-(4-aminopyrrolo[2,3-d]pyrimidin-7-yl)-3-[2-[6-(difluoromethyl)-5-fluoro-3-methyl-1,2,3,4-tetrahydroisoquinolin-8-yl]ethyl]cyclopent-3-ene-1,2-diol (PubChem CID 175573675) has the molecular formula C24H26F3N5O2 and a molecular weight of 473.50 g/mol. Its IUPAC name is (1R)-5-(4-aminopyrrolo[2,3-d]pyrimidin-7-yl)-3-[2-[6-(difluoromethyl)-5-fluoro-3-methyl-1,2,3,4-tetrahydroisoquinolin-8-yl]ethyl]cyclopent-3-ene-1,2-diol.
| Compound Name | (1R)-5-(4-aminopyrrolo[2,3-d]pyrimidin-7-yl)-3-[2-[6-(difluoromethyl)-5-fluoro-3-methyl-1,2,3,4-tetrahydroisoquinolin-8-yl]ethyl]cyclopent-3-ene-1,2-diol |
|---|---|
| PubChem CID | 175573675 |
| Molecular Formula | C24H26F3N5O2 |
| Molecular Weight | 473.50 g/mol |
| Exact Mass | 473.20 |
| IUPAC Name | (1R)-5-(4-aminopyrrolo[2,3-d]pyrimidin-7-yl)-3-[2-[6-(difluoromethyl)-5-fluoro-3-methyl-1,2,3,4-tetrahydroisoquinolin-8-yl]ethyl]cyclopent-3-ene-1,2-diol |
| SMILES | CC1Cc2c(F)c(C(F)F)cc(CCC3=CC(n4ccc5c(N)ncnc54)[C@@H](O)C3O)c2CN1 |
| InChI | InChI=1S/C24H26F3N5O2/c1-11-6-15-17(9-29-11)12(7-16(19(15)25)22(26)27)2-3-13-8-18(21(34)20(13)33)32-5-4-14-23(28)30-10-31-24(14)32/h4-5,7-8,10-11,18,20-22,29,33-34H,2-3,6,9H2,1H3,(H2,28,30,31)/t11?,18?,20?,21-/m1/s1 |
| InChIKey | NDJDREZURXRPFD-WCYRNRGBSA-N |
| XLogP | 2.96 |
| TPSA | 109.22 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.50 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|