C30H32N4O2 — CID 164933601
7-[2-[(3aR,6R,6aS)-2,2-dimethyl-6-pyrrolo[2,3-b]pyridin-1-yl-6,6a-dihydro-3aH-cyclopenta[d][1,3]dioxol-4-yl]ethyl]-N-cyclobutylquinolin-2-amine (PubChem CID 164933601) has the molecular formula C30H32N4O2 and a molecular weight of 480.61 g/mol. Its IUPAC name is 7-[2-[(3aR,6R,6aS)-2,2-dimethyl-6-pyrrolo[2,3-b]pyridin-1-yl-6,6a-dihydro-3aH-cyclopenta[d][1,3]dioxol-4-yl]ethyl]-N-cyclobutylquinolin-2-amine.
| Compound Name | 7-[2-[(3aR,6R,6aS)-2,2-dimethyl-6-pyrrolo[2,3-b]pyridin-1-yl-6,6a-dihydro-3aH-cyclopenta[d][1,3]dioxol-4-yl]ethyl]-N-cyclobutylquinolin-2-amine |
|---|---|
| PubChem CID | 164933601 |
| Molecular Formula | C30H32N4O2 |
| Molecular Weight | 480.61 g/mol |
| Exact Mass | 480.25 |
| IUPAC Name | 7-[2-[(3aR,6R,6aS)-2,2-dimethyl-6-pyrrolo[2,3-b]pyridin-1-yl-6,6a-dihydro-3aH-cyclopenta[d][1,3]dioxol-4-yl]ethyl]-N-cyclobutylquinolin-2-amine |
| SMILES | CC1(C)O[C@@H]2[C@H](O1)C(CCc1ccc3ccc(NC4CCC4)nc3c1)=C[C@H]2n1ccc2cccnc21 |
| InChI | InChI=1S/C30H32N4O2/c1-30(2)35-27-22(18-25(28(27)36-30)34-16-14-21-5-4-15-31-29(21)34)11-9-19-8-10-20-12-13-26(33-24(20)17-19)32-23-6-3-7-23/h4-5,8,10,12-18,23,25,27-28H,3,6-7,9,11H2,1-2H3,(H,32,33)/t25-,27-,28+/m1/s1 |
| InChIKey | QTKSRXLIZBKOGJ-KZQOYIJHSA-N |
| XLogP | 6.18 |
| TPSA | 61.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.61 |
| LogP ≤ 5 | 6.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|