C25H25ClN6O2 — CID 138748490
7-[2-[(3aR,6R,6aS)-6-(2-aminopyrrolo[2,3-d]pyrimidin-7-yl)-2,2-dimethyl-6,6a-dihydro-3aH-cyclopenta[d][1,3]dioxol-4-yl]ethyl]-3-chloroquinolin-2-amine (PubChem CID 138748490) has the molecular formula C25H25ClN6O2 and a molecular weight of 476.97 g/mol. Its IUPAC name is 7-[2-[(3aR,6R,6aS)-6-(2-aminopyrrolo[2,3-d]pyrimidin-7-yl)-2,2-dimethyl-6,6a-dihydro-3aH-cyclopenta[d][1,3]dioxol-4-yl]ethyl]-3-chloroquinolin-2-amine.
| Compound Name | 7-[2-[(3aR,6R,6aS)-6-(2-aminopyrrolo[2,3-d]pyrimidin-7-yl)-2,2-dimethyl-6,6a-dihydro-3aH-cyclopenta[d][1,3]dioxol-4-yl]ethyl]-3-chloroquinolin-2-amine |
|---|---|
| PubChem CID | 138748490 |
| Molecular Formula | C25H25ClN6O2 |
| Molecular Weight | 476.97 g/mol |
| Exact Mass | 476.17 |
| IUPAC Name | 7-[2-[(3aR,6R,6aS)-6-(2-aminopyrrolo[2,3-d]pyrimidin-7-yl)-2,2-dimethyl-6,6a-dihydro-3aH-cyclopenta[d][1,3]dioxol-4-yl]ethyl]-3-chloroquinolin-2-amine |
| SMILES | CC1(C)O[C@@H]2[C@H](O1)C(CCc1ccc3cc(Cl)c(N)nc3c1)=C[C@H]2n1ccc2cnc(N)nc21 |
| InChI | InChI=1S/C25H25ClN6O2/c1-25(2)33-20-15(6-4-13-3-5-14-10-17(26)22(27)30-18(14)9-13)11-19(21(20)34-25)32-8-7-16-12-29-24(28)31-23(16)32/h3,5,7-12,19-21H,4,6H2,1-2H3,(H2,27,30)(H2,28,29,31)/t19-,20-,21+/m1/s1 |
| InChIKey | KZMZAQHYZOOZPX-NJYVYQBISA-N |
| XLogP | 4.43 |
| TPSA | 114.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.97 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|