C22H21ClN6O2 — CID 164518096
(1S,2R)-3-[2-(2-amino-3-chloroquinolin-7-yl)ethyl]-5-(2-aminopyrrolo[2,3-d]pyrimidin-7-yl)cyclopent-3-ene-1,2-diol (PubChem CID 164518096) has the molecular formula C22H21ClN6O2 and a molecular weight of 436.90 g/mol. Its IUPAC name is (1S,2R)-3-[2-(2-amino-3-chloroquinolin-7-yl)ethyl]-5-(2-aminopyrrolo[2,3-d]pyrimidin-7-yl)cyclopent-3-ene-1,2-diol.
| Compound Name | (1S,2R)-3-[2-(2-amino-3-chloroquinolin-7-yl)ethyl]-5-(2-aminopyrrolo[2,3-d]pyrimidin-7-yl)cyclopent-3-ene-1,2-diol |
|---|---|
| PubChem CID | 164518096 |
| Molecular Formula | C22H21ClN6O2 |
| Molecular Weight | 436.90 g/mol |
| Exact Mass | 436.14 |
| IUPAC Name | (1S,2R)-3-[2-(2-amino-3-chloroquinolin-7-yl)ethyl]-5-(2-aminopyrrolo[2,3-d]pyrimidin-7-yl)cyclopent-3-ene-1,2-diol |
| SMILES | Nc1ncc2ccn(C3C=C(CCc4ccc5cc(Cl)c(N)nc5c4)[C@@H](O)[C@H]3O)c2n1 |
| InChI | InChI=1S/C22H21ClN6O2/c23-15-8-12-3-1-11(7-16(12)27-20(15)24)2-4-13-9-17(19(31)18(13)30)29-6-5-14-10-26-22(25)28-21(14)29/h1,3,5-10,17-19,30-31H,2,4H2,(H2,24,27)(H2,25,26,28)/t17?,18-,19+/m1/s1 |
| InChIKey | YSPFXEOLLBCBCU-CPSIJMPNSA-N |
| XLogP | 2.63 |
| TPSA | 136.10 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.90 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|