C24H26ClN5O2 — CID 160671087
(1S,2R,3S,5R)-3-[2-(2-amino-3-chloroquinolin-7-yl)ethyl]-5-(4-aminopyrrolo[2,3-b]pyridin-1-yl)-3-methylcyclopentane-1,2-diol (PubChem CID 160671087) has the molecular formula C24H26ClN5O2 and a molecular weight of 451.96 g/mol. Its IUPAC name is (1S,2R,3S,5R)-3-[2-(2-amino-3-chloroquinolin-7-yl)ethyl]-5-(4-aminopyrrolo[2,3-b]pyridin-1-yl)-3-methylcyclopentane-1,2-diol.
| Compound Name | (1S,2R,3S,5R)-3-[2-(2-amino-3-chloroquinolin-7-yl)ethyl]-5-(4-aminopyrrolo[2,3-b]pyridin-1-yl)-3-methylcyclopentane-1,2-diol |
|---|---|
| PubChem CID | 160671087 |
| Molecular Formula | C24H26ClN5O2 |
| Molecular Weight | 451.96 g/mol |
| Exact Mass | 451.18 |
| IUPAC Name | (1S,2R,3S,5R)-3-[2-(2-amino-3-chloroquinolin-7-yl)ethyl]-5-(4-aminopyrrolo[2,3-b]pyridin-1-yl)-3-methylcyclopentane-1,2-diol |
| SMILES | C[C@]1(CCc2ccc3cc(Cl)c(N)nc3c2)C[C@@H](n2ccc3c(N)ccnc32)[C@H](O)[C@@H]1O |
| InChI | InChI=1S/C24H26ClN5O2/c1-24(7-4-13-2-3-14-11-16(25)22(27)29-18(14)10-13)12-19(20(31)21(24)32)30-9-6-15-17(26)5-8-28-23(15)30/h2-3,5-6,8-11,19-21,31-32H,4,7,12H2,1H3,(H2,26,28)(H2,27,29)/t19-,20+,21+,24+/m1/s1 |
| InChIKey | WBLZSWZVEWCPBM-XBJMDHIQSA-N |
| XLogP | 3.71 |
| TPSA | 123.21 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.96 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |