C24H23ClF3N5O2 — CID 158042552
(1S,2R,3R,5R)-3-[2-(2-amino-3-chloro-5-fluoroquinolin-7-yl)ethyl]-5-(4-aminopyrrolo[2,3-b]pyridin-1-yl)-3-(difluoromethyl)cyclopentane-1,2-diol (PubChem CID 158042552) has the molecular formula C24H23ClF3N5O2 and a molecular weight of 505.93 g/mol. Its IUPAC name is (1S,2R,3R,5R)-3-[2-(2-amino-3-chloro-5-fluoroquinolin-7-yl)ethyl]-5-(4-aminopyrrolo[2,3-b]pyridin-1-yl)-3-(difluoromethyl)cyclopentane-1,2-diol.
| Compound Name | (1S,2R,3R,5R)-3-[2-(2-amino-3-chloro-5-fluoroquinolin-7-yl)ethyl]-5-(4-aminopyrrolo[2,3-b]pyridin-1-yl)-3-(difluoromethyl)cyclopentane-1,2-diol |
|---|---|
| PubChem CID | 158042552 |
| Molecular Formula | C24H23ClF3N5O2 |
| Molecular Weight | 505.93 g/mol |
| Exact Mass | 505.15 |
| IUPAC Name | (1S,2R,3R,5R)-3-[2-(2-amino-3-chloro-5-fluoroquinolin-7-yl)ethyl]-5-(4-aminopyrrolo[2,3-b]pyridin-1-yl)-3-(difluoromethyl)cyclopentane-1,2-diol |
| SMILES | Nc1nc2cc(CC[C@@]3(C(F)F)C[C@@H](n4ccc5c(N)ccnc54)[C@H](O)[C@@H]3O)cc(F)c2cc1Cl |
| InChI | InChI=1S/C24H23ClF3N5O2/c25-14-9-13-15(26)7-11(8-17(13)32-21(14)30)1-4-24(23(27)28)10-18(19(34)20(24)35)33-6-3-12-16(29)2-5-31-22(12)33/h2-3,5-9,18-20,23,34-35H,1,4,10H2,(H2,29,31)(H2,30,32)/t18-,19+,20+,24-/m1/s1 |
| InChIKey | VOVSQWDTEKYZCB-KCOOYEKVSA-N |
| XLogP | 4.09 |
| TPSA | 123.21 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.93 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |