C24H24ClF2N5O2 — CID 158042551
(1S,2R,3R,5R)-3-[2-(2-amino-3-chloro-5-fluoroquinolin-7-yl)ethyl]-5-(4-aminopyrrolo[2,3-b]pyridin-1-yl)-3-(fluoromethyl)cyclopentane-1,2-diol (PubChem CID 158042551) has the molecular formula C24H24ClF2N5O2 and a molecular weight of 487.94 g/mol. Its IUPAC name is (1S,2R,3R,5R)-3-[2-(2-amino-3-chloro-5-fluoroquinolin-7-yl)ethyl]-5-(4-aminopyrrolo[2,3-b]pyridin-1-yl)-3-(fluoromethyl)cyclopentane-1,2-diol.
| Compound Name | (1S,2R,3R,5R)-3-[2-(2-amino-3-chloro-5-fluoroquinolin-7-yl)ethyl]-5-(4-aminopyrrolo[2,3-b]pyridin-1-yl)-3-(fluoromethyl)cyclopentane-1,2-diol |
|---|---|
| PubChem CID | 158042551 |
| Molecular Formula | C24H24ClF2N5O2 |
| Molecular Weight | 487.94 g/mol |
| Exact Mass | 487.16 |
| IUPAC Name | (1S,2R,3R,5R)-3-[2-(2-amino-3-chloro-5-fluoroquinolin-7-yl)ethyl]-5-(4-aminopyrrolo[2,3-b]pyridin-1-yl)-3-(fluoromethyl)cyclopentane-1,2-diol |
| SMILES | Nc1nc2cc(CC[C@@]3(CF)C[C@@H](n4ccc5c(N)ccnc54)[C@H](O)[C@@H]3O)cc(F)c2cc1Cl |
| InChI | InChI=1S/C24H24ClF2N5O2/c25-15-9-14-16(27)7-12(8-18(14)31-22(15)29)1-4-24(11-26)10-19(20(33)21(24)34)32-6-3-13-17(28)2-5-30-23(13)32/h2-3,5-9,19-21,33-34H,1,4,10-11H2,(H2,28,30)(H2,29,31)/t19-,20+,21+,24+/m1/s1 |
| InChIKey | HNPIIPOTQULZJR-XBJMDHIQSA-N |
| XLogP | 3.80 |
| TPSA | 123.21 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.94 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |