C28H26ClN5O2 — CID 167695814
3-[(3aR,6R,6aS)-4-[2-(3-chloro-2-methylquinolin-7-yl)ethyl]-2,2-dimethyl-6,6a-dihydro-3aH-cyclopenta[d][1,3]dioxol-6-yl]-1,3,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),4,7,9,11-pentaene (PubChem CID 167695814) has the molecular formula C28H26ClN5O2 and a molecular weight of 500.00 g/mol. Its IUPAC name is 3-[(3aR,6R,6aS)-4-[2-(3-chloro-2-methylquinolin-7-yl)ethyl]-2,2-dimethyl-6,6a-dihydro-3aH-cyclopenta[d][1,3]dioxol-6-yl]-1,3,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),4,7,9,11-pentaene.
| Compound Name | 3-[(3aR,6R,6aS)-4-[2-(3-chloro-2-methylquinolin-7-yl)ethyl]-2,2-dimethyl-6,6a-dihydro-3aH-cyclopenta[d][1,3]dioxol-6-yl]-1,3,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),4,7,9,11-pentaene |
|---|---|
| PubChem CID | 167695814 |
| Molecular Formula | C28H26ClN5O2 |
| Molecular Weight | 500.00 g/mol |
| Exact Mass | 499.18 |
| IUPAC Name | 3-[(3aR,6R,6aS)-4-[2-(3-chloro-2-methylquinolin-7-yl)ethyl]-2,2-dimethyl-6,6a-dihydro-3aH-cyclopenta[d][1,3]dioxol-6-yl]-1,3,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),4,7,9,11-pentaene |
| SMILES | Cc1nc2cc(CCC3=C[C@@H](n4ccc5cnc6nccn6c54)[C@@H]4OC(C)(C)O[C@H]34)ccc2cc1Cl |
| InChI | InChI=1S/C28H26ClN5O2/c1-16-21(29)13-18-6-4-17(12-22(18)32-16)5-7-19-14-23(25-24(19)35-28(2,3)36-25)33-10-8-20-15-31-27-30-9-11-34(27)26(20)33/h4,6,8-15,23-25H,5,7H2,1-3H3/t23-,24-,25+/m1/s1 |
| InChIKey | XQHYNFKFRQTYGN-SDHSZQHLSA-N |
| XLogP | 5.83 |
| TPSA | 66.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.00 |
| LogP ≤ 5 | 5.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|