C25H27ClN6O3 — CID 170081174
7-[2-[(3aR,6aR)-2,2-dimethyl-4-[4-(methylamino)pyrrolo[2,3-d]pyrimidin-7-yl]-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]ethyl]-3-chloroquinolin-2-amine (PubChem CID 170081174) has the molecular formula C25H27ClN6O3 and a molecular weight of 494.98 g/mol. Its IUPAC name is 7-[2-[(3aR,6aR)-2,2-dimethyl-4-[4-(methylamino)pyrrolo[2,3-d]pyrimidin-7-yl]-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]ethyl]-3-chloroquinolin-2-amine.
| Compound Name | 7-[2-[(3aR,6aR)-2,2-dimethyl-4-[4-(methylamino)pyrrolo[2,3-d]pyrimidin-7-yl]-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]ethyl]-3-chloroquinolin-2-amine |
|---|---|
| PubChem CID | 170081174 |
| Molecular Formula | C25H27ClN6O3 |
| Molecular Weight | 494.98 g/mol |
| Exact Mass | 494.18 |
| IUPAC Name | 7-[2-[(3aR,6aR)-2,2-dimethyl-4-[4-(methylamino)pyrrolo[2,3-d]pyrimidin-7-yl]-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]ethyl]-3-chloroquinolin-2-amine |
| SMILES | CNc1ncnc2c1ccn2C1OC(CCc2ccc3cc(Cl)c(N)nc3c2)[C@H]2OC(C)(C)O[C@@H]12 |
| InChI | InChI=1S/C25H27ClN6O3/c1-25(2)34-19-18(7-5-13-4-6-14-11-16(26)21(27)31-17(14)10-13)33-24(20(19)35-25)32-9-8-15-22(28-3)29-12-30-23(15)32/h4,6,8-12,18-20,24H,5,7H2,1-3H3,(H2,27,31)(H,28,29,30)/t18?,19-,20-,24?/m1/s1 |
| InChIKey | SAUXMSWNKFIGAE-NCMKUFGYSA-N |
| XLogP | 4.31 |
| TPSA | 109.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.98 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |