C25H26BrN5O4 — CID 161099115
7-[[(3aR,4R,6R,6aR)-4-(4-ethylpyrrolo[2,3-d]pyrimidin-7-yl)-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]methoxy]-3-bromoquinolin-2-amine (PubChem CID 161099115) has the molecular formula C25H26BrN5O4 and a molecular weight of 540.42 g/mol. Its IUPAC name is 7-[[(3aR,4R,6R,6aR)-4-(4-ethylpyrrolo[2,3-d]pyrimidin-7-yl)-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]methoxy]-3-bromoquinolin-2-amine.
| Compound Name | 7-[[(3aR,4R,6R,6aR)-4-(4-ethylpyrrolo[2,3-d]pyrimidin-7-yl)-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]methoxy]-3-bromoquinolin-2-amine |
|---|---|
| PubChem CID | 161099115 |
| Molecular Formula | C25H26BrN5O4 |
| Molecular Weight | 540.42 g/mol |
| Exact Mass | 539.12 |
| IUPAC Name | 7-[[(3aR,4R,6R,6aR)-4-(4-ethylpyrrolo[2,3-d]pyrimidin-7-yl)-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]methoxy]-3-bromoquinolin-2-amine |
| SMILES | CCc1ncnc2c1ccn2[C@@H]1O[C@H](COc2ccc3cc(Br)c(N)nc3c2)[C@H]2OC(C)(C)O[C@H]21 |
| InChI | InChI=1S/C25H26BrN5O4/c1-4-17-15-7-8-31(23(15)29-12-28-17)24-21-20(34-25(2,3)35-21)19(33-24)11-32-14-6-5-13-9-16(26)22(27)30-18(13)10-14/h5-10,12,19-21,24H,4,11H2,1-3H3,(H2,27,30)/t19-,20-,21-,24-/m1/s1 |
| InChIKey | UIEQEXRMAWFRSN-GECPAALWSA-N |
| XLogP | 4.38 |
| TPSA | 106.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.42 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |