C23H21BrClN5O3S — CID 146348256
7-[[(3aR,4R,6R,6aS)-4-(4-chloropyrrolo[2,3-d]pyrimidin-7-yl)-2,2-dimethyl-3a,4,6,6a-tetrahydrothieno[3,4-d][1,3]dioxol-6-yl]methoxy]-3-bromoquinolin-2-amine (PubChem CID 146348256) has the molecular formula C23H21BrClN5O3S and a molecular weight of 562.88 g/mol. Its IUPAC name is 7-[[(3aR,4R,6R,6aS)-4-(4-chloropyrrolo[2,3-d]pyrimidin-7-yl)-2,2-dimethyl-3a,4,6,6a-tetrahydrothieno[3,4-d][1,3]dioxol-6-yl]methoxy]-3-bromoquinolin-2-amine.
| Compound Name | 7-[[(3aR,4R,6R,6aS)-4-(4-chloropyrrolo[2,3-d]pyrimidin-7-yl)-2,2-dimethyl-3a,4,6,6a-tetrahydrothieno[3,4-d][1,3]dioxol-6-yl]methoxy]-3-bromoquinolin-2-amine |
|---|---|
| PubChem CID | 146348256 |
| Molecular Formula | C23H21BrClN5O3S |
| Molecular Weight | 562.88 g/mol |
| Exact Mass | 561.02 |
| IUPAC Name | 7-[[(3aR,4R,6R,6aS)-4-(4-chloropyrrolo[2,3-d]pyrimidin-7-yl)-2,2-dimethyl-3a,4,6,6a-tetrahydrothieno[3,4-d][1,3]dioxol-6-yl]methoxy]-3-bromoquinolin-2-amine |
| SMILES | CC1(C)O[C@@H]2[C@H](O1)[C@@H](COc1ccc3cc(Br)c(N)nc3c1)S[C@H]2n1ccc2c(Cl)ncnc21 |
| InChI | InChI=1S/C23H21BrClN5O3S/c1-23(2)32-17-16(9-31-12-4-3-11-7-14(24)20(26)29-15(11)8-12)34-22(18(17)33-23)30-6-5-13-19(25)27-10-28-21(13)30/h3-8,10,16-18,22H,9H2,1-2H3,(H2,26,29)/t16-,17-,18-,22-/m1/s1 |
| InChIKey | XRZWJSQOJSPCME-OZQHCQBDSA-N |
| XLogP | 5.19 |
| TPSA | 97.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.88 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |