C25H29ClN6O2 — CID 167041873
2-[(1R,2R,4S)-4-[2-(2-amino-3-chloroquinolin-7-yl)ethyl]-2-(4-aminopyrrolo[2,3-d]pyrimidin-7-yl)cyclopentyl]oxypropan-2-ol (PubChem CID 167041873) has the molecular formula C25H29ClN6O2 and a molecular weight of 481.00 g/mol. Its IUPAC name is 2-[(1R,2R,4S)-4-[2-(2-amino-3-chloroquinolin-7-yl)ethyl]-2-(4-aminopyrrolo[2,3-d]pyrimidin-7-yl)cyclopentyl]oxypropan-2-ol.
| Compound Name | 2-[(1R,2R,4S)-4-[2-(2-amino-3-chloroquinolin-7-yl)ethyl]-2-(4-aminopyrrolo[2,3-d]pyrimidin-7-yl)cyclopentyl]oxypropan-2-ol |
|---|---|
| PubChem CID | 167041873 |
| Molecular Formula | C25H29ClN6O2 |
| Molecular Weight | 481.00 g/mol |
| Exact Mass | 480.20 |
| IUPAC Name | 2-[(1R,2R,4S)-4-[2-(2-amino-3-chloroquinolin-7-yl)ethyl]-2-(4-aminopyrrolo[2,3-d]pyrimidin-7-yl)cyclopentyl]oxypropan-2-ol |
| SMILES | CC(C)(O)O[C@@H]1C[C@@H](CCc2ccc3cc(Cl)c(N)nc3c2)C[C@H]1n1ccc2c(N)ncnc21 |
| InChI | InChI=1S/C25H29ClN6O2/c1-25(2,33)34-21-11-15(10-20(21)32-8-7-17-22(27)29-13-30-24(17)32)4-3-14-5-6-16-12-18(26)23(28)31-19(16)9-14/h5-9,12-13,15,20-21,33H,3-4,10-11H2,1-2H3,(H2,28,31)(H2,27,29,30)/t15-,20+,21+/m0/s1 |
| InChIKey | KBYOBTWTBHKQTE-IWMITWMQSA-N |
| XLogP | 4.49 |
| TPSA | 125.10 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.00 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|