C27H27ClFN5O2 — CID 172722097
3-chloro-7-[2-[(1R,2R,4S,5R,6S)-8,8-dimethyl-5-(4-methylpyrrolo[2,3-d]pyrimidin-7-yl)-7,9-dioxatricyclo[4.3.0.02,4]nonan-2-yl]ethyl]-5-fluoroquinolin-2-amine (PubChem CID 172722097) has the molecular formula C27H27ClFN5O2 and a molecular weight of 508.00 g/mol. Its IUPAC name is 3-chloro-7-[2-[(1R,2R,4S,5R,6S)-8,8-dimethyl-5-(4-methylpyrrolo[2,3-d]pyrimidin-7-yl)-7,9-dioxatricyclo[4.3.0.02,4]nonan-2-yl]ethyl]-5-fluoroquinolin-2-amine.
| Compound Name | 3-chloro-7-[2-[(1R,2R,4S,5R,6S)-8,8-dimethyl-5-(4-methylpyrrolo[2,3-d]pyrimidin-7-yl)-7,9-dioxatricyclo[4.3.0.02,4]nonan-2-yl]ethyl]-5-fluoroquinolin-2-amine |
|---|---|
| PubChem CID | 172722097 |
| Molecular Formula | C27H27ClFN5O2 |
| Molecular Weight | 508.00 g/mol |
| Exact Mass | 507.18 |
| IUPAC Name | 3-chloro-7-[2-[(1R,2R,4S,5R,6S)-8,8-dimethyl-5-(4-methylpyrrolo[2,3-d]pyrimidin-7-yl)-7,9-dioxatricyclo[4.3.0.02,4]nonan-2-yl]ethyl]-5-fluoroquinolin-2-amine |
| SMILES | Cc1ncnc2c1ccn2[C@H]1[C@@H]2OC(C)(C)O[C@@H]2[C@]2(CCc3cc(F)c4cc(Cl)c(N)nc4c3)C[C@H]12 |
| InChI | InChI=1S/C27H27ClFN5O2/c1-13-15-5-7-34(25(15)32-12-31-13)21-17-11-27(17,23-22(21)35-26(2,3)36-23)6-4-14-8-19(29)16-10-18(28)24(30)33-20(16)9-14/h5,7-10,12,17,21-23H,4,6,11H2,1-3H3,(H2,30,33)/t17-,21-,22+,23+,27-/m1/s1 |
| InChIKey | GQPQHFAZRNXDME-DXTWCIHJSA-N |
| XLogP | 5.38 |
| TPSA | 88.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.00 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |