C23H24ClFN4O2 — CID 164933537
(2R,3S,4R,5S)-1-[2-(2-amino-3-chloro-5-fluoroquinolin-7-yl)ethyl]-4-[2-methyl-5-(methylideneamino)pyrrol-1-yl]bicyclo[3.1.0]hexane-2,3-diol (PubChem CID 164933537) has the molecular formula C23H24ClFN4O2 and a molecular weight of 442.92 g/mol. Its IUPAC name is (2R,3S,4R,5S)-1-[2-(2-amino-3-chloro-5-fluoroquinolin-7-yl)ethyl]-4-[2-methyl-5-(methylideneamino)pyrrol-1-yl]bicyclo[3.1.0]hexane-2,3-diol.
| Compound Name | (2R,3S,4R,5S)-1-[2-(2-amino-3-chloro-5-fluoroquinolin-7-yl)ethyl]-4-[2-methyl-5-(methylideneamino)pyrrol-1-yl]bicyclo[3.1.0]hexane-2,3-diol |
|---|---|
| PubChem CID | 164933537 |
| Molecular Formula | C23H24ClFN4O2 |
| Molecular Weight | 442.92 g/mol |
| Exact Mass | 442.16 |
| IUPAC Name | (2R,3S,4R,5S)-1-[2-(2-amino-3-chloro-5-fluoroquinolin-7-yl)ethyl]-4-[2-methyl-5-(methylideneamino)pyrrol-1-yl]bicyclo[3.1.0]hexane-2,3-diol |
| SMILES | C=Nc1ccc(C)n1[C@H]1[C@H](O)[C@H](O)C2(CCc3cc(F)c4cc(Cl)c(N)nc4c3)C[C@H]12 |
| InChI | InChI=1S/C23H24ClFN4O2/c1-11-3-4-18(27-2)29(11)19-14-10-23(14,21(31)20(19)30)6-5-12-7-16(25)13-9-15(24)22(26)28-17(13)8-12/h3-4,7-9,14,19-21,30-31H,2,5-6,10H2,1H3,(H2,26,28)/t14-,19-,20+,21+,23?/m1/s1 |
| InChIKey | LWMWOWICSJPEQQ-IFWNXUPCSA-N |
| XLogP | 3.97 |
| TPSA | 96.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.92 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|