C23H26N4O2 — CID 167635981
(1S,2R,3S,4R,5S)-1-[2-(2-amino-3-methylquinolin-7-yl)ethyl]-4-[2-(methylideneamino)pyrrol-1-yl]bicyclo[3.1.0]hexane-2,3-diol (PubChem CID 167635981) has the molecular formula C23H26N4O2 and a molecular weight of 390.49 g/mol. Its IUPAC name is (1S,2R,3S,4R,5S)-1-[2-(2-amino-3-methylquinolin-7-yl)ethyl]-4-[2-(methylideneamino)pyrrol-1-yl]bicyclo[3.1.0]hexane-2,3-diol.
| Compound Name | (1S,2R,3S,4R,5S)-1-[2-(2-amino-3-methylquinolin-7-yl)ethyl]-4-[2-(methylideneamino)pyrrol-1-yl]bicyclo[3.1.0]hexane-2,3-diol |
|---|---|
| PubChem CID | 167635981 |
| Molecular Formula | C23H26N4O2 |
| Molecular Weight | 390.49 g/mol |
| Exact Mass | 390.21 |
| IUPAC Name | (1S,2R,3S,4R,5S)-1-[2-(2-amino-3-methylquinolin-7-yl)ethyl]-4-[2-(methylideneamino)pyrrol-1-yl]bicyclo[3.1.0]hexane-2,3-diol |
| SMILES | C=Nc1cccn1[C@H]1[C@H](O)[C@H](O)[C@@]2(CCc3ccc4cc(C)c(N)nc4c3)C[C@H]12 |
| InChI | InChI=1S/C23H26N4O2/c1-13-10-15-6-5-14(11-17(15)26-22(13)24)7-8-23-12-16(23)19(20(28)21(23)29)27-9-3-4-18(27)25-2/h3-6,9-11,16,19-21,28-29H,2,7-8,12H2,1H3,(H2,24,26)/t16-,19-,20+,21+,23+/m1/s1 |
| InChIKey | OMDRUGPDHNCISM-GGKYTPRKSA-N |
| XLogP | 3.17 |
| TPSA | 96.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.49 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|