C18H22N2O4 — CID 167592599
(3R,3aS,6S,6aR)-6-[(2-amino-3-methylquinolin-7-yl)methyl]-2,3,4,5,6,6a-hexahydrocyclopenta[b]furan-2,3,3a-triol (PubChem CID 167592599) has the molecular formula C18H22N2O4 and a molecular weight of 330.38 g/mol. Its IUPAC name is (3R,3aS,6S,6aR)-6-[(2-amino-3-methylquinolin-7-yl)methyl]-2,3,4,5,6,6a-hexahydrocyclopenta[b]furan-2,3,3a-triol.
| Compound Name | (3R,3aS,6S,6aR)-6-[(2-amino-3-methylquinolin-7-yl)methyl]-2,3,4,5,6,6a-hexahydrocyclopenta[b]furan-2,3,3a-triol |
|---|---|
| PubChem CID | 167592599 |
| Molecular Formula | C18H22N2O4 |
| Molecular Weight | 330.38 g/mol |
| Exact Mass | 330.16 |
| IUPAC Name | (3R,3aS,6S,6aR)-6-[(2-amino-3-methylquinolin-7-yl)methyl]-2,3,4,5,6,6a-hexahydrocyclopenta[b]furan-2,3,3a-triol |
| SMILES | Cc1cc2ccc(C[C@@H]3CC[C@@]4(O)[C@@H]3OC(O)[C@@H]4O)cc2nc1N |
| InChI | InChI=1S/C18H22N2O4/c1-9-6-11-3-2-10(8-13(11)20-16(9)19)7-12-4-5-18(23)14(21)17(22)24-15(12)18/h2-3,6,8,12,14-15,17,21-23H,4-5,7H2,1H3,(H2,19,20)/t12-,14-,15+,17?,18-/m0/s1 |
| InChIKey | IPWDINRCSDLCKA-USZDDDHQSA-N |
| XLogP | 0.89 |
| TPSA | 108.83 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.38 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |