C24H20ClFN6O2 — CID 138748178
(1S,2R,3S,4R,5S)-1-[2-(2-amino-3-chloro-8-fluoroquinolin-7-yl)ethyl]-4-(4-aminopyrrolo[2,3-d]pyrimidin-7-yl)bicyclo[3.2.0]hept-6-yne-2,3-diol (PubChem CID 138748178) has the molecular formula C24H20ClFN6O2 and a molecular weight of 478.92 g/mol. Its IUPAC name is (1S,2R,3S,4R,5S)-1-[2-(2-amino-3-chloro-8-fluoroquinolin-7-yl)ethyl]-4-(4-aminopyrrolo[2,3-d]pyrimidin-7-yl)bicyclo[3.2.0]hept-6-yne-2,3-diol.
| Compound Name | (1S,2R,3S,4R,5S)-1-[2-(2-amino-3-chloro-8-fluoroquinolin-7-yl)ethyl]-4-(4-aminopyrrolo[2,3-d]pyrimidin-7-yl)bicyclo[3.2.0]hept-6-yne-2,3-diol |
|---|---|
| PubChem CID | 138748178 |
| Molecular Formula | C24H20ClFN6O2 |
| Molecular Weight | 478.92 g/mol |
| Exact Mass | 478.13 |
| IUPAC Name | (1S,2R,3S,4R,5S)-1-[2-(2-amino-3-chloro-8-fluoroquinolin-7-yl)ethyl]-4-(4-aminopyrrolo[2,3-d]pyrimidin-7-yl)bicyclo[3.2.0]hept-6-yne-2,3-diol |
| SMILES | Nc1nc2c(F)c(CC[C@@]34C#C[C@@H]3[C@@H](n3ccc5c(N)ncnc53)[C@H](O)[C@@H]4O)ccc2cc1Cl |
| InChI | InChI=1S/C24H20ClFN6O2/c25-15-9-12-2-1-11(16(26)17(12)31-22(15)28)3-6-24-7-4-14(24)18(19(33)20(24)34)32-8-5-13-21(27)29-10-30-23(13)32/h1-2,5,8-10,14,18-20,33-34H,3,6H2,(H2,28,31)(H2,27,29,30)/t14-,18-,19+,20+,24-/m1/s1 |
| InChIKey | VGDZXCKGIWLTFO-YSDALADHSA-N |
| XLogP | 2.47 |
| TPSA | 136.10 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.92 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|