C19H23Cl2N5O2 — CID 155557387
(1S,2R,3S,4R,5S)-4-[6-[[(1R,2S,4S)-2-bicyclo[2.2.1]heptanyl]amino]-2-chloropurin-9-yl]-1-(chloromethyl)bicyclo[3.1.0]hexane-2,3-diol (PubChem CID 155557387) has the molecular formula C19H23Cl2N5O2 and a molecular weight of 424.33 g/mol. Its IUPAC name is (1S,2R,3S,4R,5S)-4-[6-[[(1R,2S,4S)-2-bicyclo[2.2.1]heptanyl]amino]-2-chloropurin-9-yl]-1-(chloromethyl)bicyclo[3.1.0]hexane-2,3-diol.
| Compound Name | (1S,2R,3S,4R,5S)-4-[6-[[(1R,2S,4S)-2-bicyclo[2.2.1]heptanyl]amino]-2-chloropurin-9-yl]-1-(chloromethyl)bicyclo[3.1.0]hexane-2,3-diol |
|---|---|
| PubChem CID | 155557387 |
| Molecular Formula | C19H23Cl2N5O2 |
| Molecular Weight | 424.33 g/mol |
| Exact Mass | 423.12 |
| IUPAC Name | (1S,2R,3S,4R,5S)-4-[6-[[(1R,2S,4S)-2-bicyclo[2.2.1]heptanyl]amino]-2-chloropurin-9-yl]-1-(chloromethyl)bicyclo[3.1.0]hexane-2,3-diol |
| SMILES | O[C@H]1[C@H](n2cnc3c(N[C@H]4C[C@H]5CC[C@@H]4C5)nc(Cl)nc32)[C@H]2C[C@@]2(CCl)[C@H]1O |
| InChI | InChI=1S/C19H23Cl2N5O2/c20-6-19-5-10(19)13(14(27)15(19)28)26-7-22-12-16(24-18(21)25-17(12)26)23-11-4-8-1-2-9(11)3-8/h7-11,13-15,27-28H,1-6H2,(H,23,24,25)/t8-,9+,10+,11-,13+,14-,15-,19-/m0/s1 |
| InChIKey | UZPVEUSTVZGUFZ-OITXHHBMSA-N |
| XLogP | 2.60 |
| TPSA | 96.09 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.33 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|