C19H28ClN5O4P+ — CID 131967818
[(3aR,4S,5S,6R,6aS)-6-(6-amino-2-chloropurin-9-yl)-4-ethyl-2,2,5-trimethyl-3a,5,6,6a-tetrahydrocyclopenta[d][1,3]dioxol-4-yl]methyl-ethoxy-oxophosphanium (PubChem CID 131967818) has the molecular formula C19H28ClN5O4P+ and a molecular weight of 456.89 g/mol. Its IUPAC name is [(3aR,4S,5S,6R,6aS)-6-(6-amino-2-chloropurin-9-yl)-4-ethyl-2,2,5-trimethyl-3a,5,6,6a-tetrahydrocyclopenta[d][1,3]dioxol-4-yl]methyl-ethoxy-oxophosphanium.
| Compound Name | [(3aR,4S,5S,6R,6aS)-6-(6-amino-2-chloropurin-9-yl)-4-ethyl-2,2,5-trimethyl-3a,5,6,6a-tetrahydrocyclopenta[d][1,3]dioxol-4-yl]methyl-ethoxy-oxophosphanium |
|---|---|
| PubChem CID | 131967818 |
| Molecular Formula | C19H28ClN5O4P+ |
| Molecular Weight | 456.89 g/mol |
| Exact Mass | 456.16 |
| IUPAC Name | [(3aR,4S,5S,6R,6aS)-6-(6-amino-2-chloropurin-9-yl)-4-ethyl-2,2,5-trimethyl-3a,5,6,6a-tetrahydrocyclopenta[d][1,3]dioxol-4-yl]methyl-ethoxy-oxophosphanium |
| SMILES | CCO[P+](=O)C[C@@]1(CC)[C@H](C)[C@@H](n2cnc3c(N)nc(Cl)nc32)[C@@H]2OC(C)(C)O[C@@H]21 |
| InChI | InChI=1S/C19H28ClN5O4P/c1-6-19(8-30(26)27-7-2)10(3)12(13-14(19)29-18(4,5)28-13)25-9-22-11-15(21)23-17(20)24-16(11)25/h9-10,12-14H,6-8H2,1-5H3,(H2,21,23,24)/q+1/t10-,12-,13+,14+,19+/m1/s1 |
| InChIKey | QHAFSBVNWYJYPT-SETQXRGISA-N |
| XLogP | 3.95 |
| TPSA | 114.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.89 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|