C17H22ClN5O5 — CID 20592053
[(3aR,4R,6R,6aR)-4-[2-chloro-6-[[(3R)-oxolan-3-yl]amino]purin-9-yl]-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]methanol (PubChem CID 20592053) has the molecular formula C17H22ClN5O5 and a molecular weight of 411.85 g/mol. Its IUPAC name is [(3aR,4R,6R,6aR)-4-[2-chloro-6-[[(3R)-oxolan-3-yl]amino]purin-9-yl]-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]methanol.
| Compound Name | [(3aR,4R,6R,6aR)-4-[2-chloro-6-[[(3R)-oxolan-3-yl]amino]purin-9-yl]-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]methanol |
|---|---|
| PubChem CID | 20592053 |
| Molecular Formula | C17H22ClN5O5 |
| Molecular Weight | 411.85 g/mol |
| Exact Mass | 411.13 |
| IUPAC Name | [(3aR,4R,6R,6aR)-4-[2-chloro-6-[[(3R)-oxolan-3-yl]amino]purin-9-yl]-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]methanol |
| SMILES | CC1(C)O[C@@H]2[C@H](O1)[C@@H](CO)O[C@H]2n1cnc2c(N[C@@H]3CCOC3)nc(Cl)nc21 |
| InChI | InChI=1S/C17H22ClN5O5/c1-17(2)27-11-9(5-24)26-15(12(11)28-17)23-7-19-10-13(20-8-3-4-25-6-8)21-16(18)22-14(10)23/h7-9,11-12,15,24H,3-6H2,1-2H3,(H,20,21,22)/t8-,9-,11-,12-,15-/m1/s1 |
| InChIKey | BWNQPHIHSOYPLB-NENBDWHOSA-N |
| XLogP | 1.09 |
| TPSA | 112.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.85 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |