C25H28ClN5O5 — CID 174010503
[(4R,6R)-4-(2-chloro-6-spiro[2H-indole-3,4'-oxane]-1-ylpurin-9-yl)-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]methanol (PubChem CID 174010503) has the molecular formula C25H28ClN5O5 and a molecular weight of 513.98 g/mol. Its IUPAC name is [(4R,6R)-4-(2-chloro-6-spiro[2H-indole-3,4'-oxane]-1-ylpurin-9-yl)-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]methanol.
| Compound Name | [(4R,6R)-4-(2-chloro-6-spiro[2H-indole-3,4'-oxane]-1-ylpurin-9-yl)-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]methanol |
|---|---|
| PubChem CID | 174010503 |
| Molecular Formula | C25H28ClN5O5 |
| Molecular Weight | 513.98 g/mol |
| Exact Mass | 513.18 |
| IUPAC Name | [(4R,6R)-4-(2-chloro-6-spiro[2H-indole-3,4'-oxane]-1-ylpurin-9-yl)-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]methanol |
| SMILES | CC1(C)OC2C(O1)[C@@H](CO)O[C@H]2n1cnc2c(N3CC4(CCOCC4)c4ccccc43)nc(Cl)nc21 |
| InChI | InChI=1S/C25H28ClN5O5/c1-24(2)35-18-16(11-32)34-22(19(18)36-24)31-13-27-17-20(28-23(26)29-21(17)31)30-12-25(7-9-33-10-8-25)14-5-3-4-6-15(14)30/h3-6,13,16,18-19,22,32H,7-12H2,1-2H3/t16-,18?,19?,22-/m1/s1 |
| InChIKey | NMERNNPMOVBJJZ-PZNXAURZSA-N |
| XLogP | 3.09 |
| TPSA | 103.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.98 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |