C24H27FN6O3 — CID 69468197
9-[(3aS,4R,6R,6aR)-6-[2-(6-fluoro-2-pyridinyl)ethenyl]-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-4-yl]-N-cyclopentylpurin-6-amine (PubChem CID 69468197) has the molecular formula C24H27FN6O3 and a molecular weight of 466.52 g/mol. Its IUPAC name is 9-[(3aS,4R,6R,6aR)-6-[2-(6-fluoro-2-pyridinyl)ethenyl]-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-4-yl]-N-cyclopentylpurin-6-amine.
| Compound Name | 9-[(3aS,4R,6R,6aR)-6-[2-(6-fluoro-2-pyridinyl)ethenyl]-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-4-yl]-N-cyclopentylpurin-6-amine |
|---|---|
| PubChem CID | 69468197 |
| Molecular Formula | C24H27FN6O3 |
| Molecular Weight | 466.52 g/mol |
| Exact Mass | 466.21 |
| IUPAC Name | 9-[(3aS,4R,6R,6aR)-6-[2-(6-fluoro-2-pyridinyl)ethenyl]-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-4-yl]-N-cyclopentylpurin-6-amine |
| SMILES | CC1(C)O[C@H]2[C@H](O1)[C@@H](C=Cc1cccc(F)n1)O[C@H]2n1cnc2c(NC3CCCC3)ncnc21 |
| InChI | InChI=1S/C24H27FN6O3/c1-24(2)33-19-16(11-10-15-8-5-9-17(25)29-15)32-23(20(19)34-24)31-13-28-18-21(26-12-27-22(18)31)30-14-6-3-4-7-14/h5,8-14,16,19-20,23H,3-4,6-7H2,1-2H3,(H,26,27,30)/t16-,19-,20+,23-/m1/s1 |
| InChIKey | WJSQZNJSCPUHNZ-LOODEUFTSA-N |
| XLogP | 3.85 |
| TPSA | 96.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.52 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|