C21H23FN6O3 — CID 69467818
(2R,3R,4S,5R)-2-[6-(cyclopentylamino)purin-9-yl]-5-[2-(6-fluoro-2-pyridinyl)ethenyl]oxolane-3,4-diol (PubChem CID 69467818) has the molecular formula C21H23FN6O3 and a molecular weight of 426.45 g/mol. Its IUPAC name is (2R,3R,4S,5R)-2-[6-(cyclopentylamino)purin-9-yl]-5-[2-(6-fluoro-2-pyridinyl)ethenyl]oxolane-3,4-diol.
| Compound Name | (2R,3R,4S,5R)-2-[6-(cyclopentylamino)purin-9-yl]-5-[2-(6-fluoro-2-pyridinyl)ethenyl]oxolane-3,4-diol |
|---|---|
| PubChem CID | 69467818 |
| Molecular Formula | C21H23FN6O3 |
| Molecular Weight | 426.45 g/mol |
| Exact Mass | 426.18 |
| IUPAC Name | (2R,3R,4S,5R)-2-[6-(cyclopentylamino)purin-9-yl]-5-[2-(6-fluoro-2-pyridinyl)ethenyl]oxolane-3,4-diol |
| SMILES | O[C@@H]1[C@H](O)[C@@H](C=Cc2cccc(F)n2)O[C@H]1n1cnc2c(NC3CCCC3)ncnc21 |
| InChI | InChI=1S/C21H23FN6O3/c22-15-7-3-6-13(26-15)8-9-14-17(29)18(30)21(31-14)28-11-25-16-19(23-10-24-20(16)28)27-12-4-1-2-5-12/h3,6-12,14,17-18,21,29-30H,1-2,4-5H2,(H,23,24,27)/t14-,17-,18-,21-/m1/s1 |
| InChIKey | XAIZACUBJZTLFF-HAXDFEGKSA-N |
| XLogP | 2.05 |
| TPSA | 118.21 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.45 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|