C23H30FN5O3 — CID 69469319
(2R,3R,4S,5R)-2-[6-(cyclopentylamino)purin-9-yl]-5-[3-(2-fluorocyclohexyl)prop-2-ynyl]oxolane-3,4-diol (PubChem CID 69469319) has the molecular formula C23H30FN5O3 and a molecular weight of 443.52 g/mol. Its IUPAC name is (2R,3R,4S,5R)-2-[6-(cyclopentylamino)purin-9-yl]-5-[3-(2-fluorocyclohexyl)prop-2-ynyl]oxolane-3,4-diol.
| Compound Name | (2R,3R,4S,5R)-2-[6-(cyclopentylamino)purin-9-yl]-5-[3-(2-fluorocyclohexyl)prop-2-ynyl]oxolane-3,4-diol |
|---|---|
| PubChem CID | 69469319 |
| Molecular Formula | C23H30FN5O3 |
| Molecular Weight | 443.52 g/mol |
| Exact Mass | 443.23 |
| IUPAC Name | (2R,3R,4S,5R)-2-[6-(cyclopentylamino)purin-9-yl]-5-[3-(2-fluorocyclohexyl)prop-2-ynyl]oxolane-3,4-diol |
| SMILES | O[C@@H]1[C@H](O)[C@@H](CC#CC2CCCCC2F)O[C@H]1n1cnc2c(NC3CCCC3)ncnc21 |
| InChI | InChI=1S/C23H30FN5O3/c24-16-10-4-1-6-14(16)7-5-11-17-19(30)20(31)23(32-17)29-13-27-18-21(25-12-26-22(18)29)28-15-8-2-3-9-15/h12-17,19-20,23,30-31H,1-4,6,8-11H2,(H,25,26,28)/t14?,16?,17-,19-,20-,23-/m1/s1 |
| InChIKey | IYLQODSXLHNYAY-DNEBCRIASA-N |
| XLogP | 2.72 |
| TPSA | 105.32 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.52 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|