C22H25N5O3 — CID 69466504
(2R,3R,4R,5R)-2-[6-(cyclopentylamino)purin-9-yl]-5-(2-phenylethenyl)oxolane-3,4-diol (PubChem CID 69466504) has the molecular formula C22H25N5O3 and a molecular weight of 407.47 g/mol. Its IUPAC name is (2R,3R,4R,5R)-2-[6-(cyclopentylamino)purin-9-yl]-5-(2-phenylethenyl)oxolane-3,4-diol.
| Compound Name | (2R,3R,4R,5R)-2-[6-(cyclopentylamino)purin-9-yl]-5-(2-phenylethenyl)oxolane-3,4-diol |
|---|---|
| PubChem CID | 69466504 |
| Molecular Formula | C22H25N5O3 |
| Molecular Weight | 407.47 g/mol |
| Exact Mass | 407.20 |
| IUPAC Name | (2R,3R,4R,5R)-2-[6-(cyclopentylamino)purin-9-yl]-5-(2-phenylethenyl)oxolane-3,4-diol |
| SMILES | O[C@@H]1[C@@H](O)[C@@H](C=Cc2ccccc2)O[C@H]1n1cnc2c(NC3CCCC3)ncnc21 |
| InChI | InChI=1S/C22H25N5O3/c28-18-16(11-10-14-6-2-1-3-7-14)30-22(19(18)29)27-13-25-17-20(23-12-24-21(17)27)26-15-8-4-5-9-15/h1-3,6-7,10-13,15-16,18-19,22,28-29H,4-5,8-9H2,(H,23,24,26)/t16-,18+,19-,22-/m1/s1 |
| InChIKey | FZOKRCLVLPATSB-ITBLURSFSA-N |
| XLogP | 2.51 |
| TPSA | 105.32 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.47 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |