C16H26N5O4Tl — CID 167504346
[[9-(2,2-dimethyl-4,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]pyran-6-yl)purin-6-yl]amino]thallium;ethane;methanol (PubChem CID 167504346) has the molecular formula C16H26N5O4Tl and a molecular weight of 556.80 g/mol. Its IUPAC name is [[9-(2,2-dimethyl-4,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]pyran-6-yl)purin-6-yl]amino]thallium;ethane;methanol.
| Compound Name | [[9-(2,2-dimethyl-4,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]pyran-6-yl)purin-6-yl]amino]thallium;ethane;methanol |
|---|---|
| PubChem CID | 167504346 |
| Molecular Formula | C16H26N5O4Tl |
| Molecular Weight | 556.80 g/mol |
| Exact Mass | 557.17 |
| IUPAC Name | [[9-(2,2-dimethyl-4,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]pyran-6-yl)purin-6-yl]amino]thallium;ethane;methanol |
| SMILES | CC.CC1(C)OC2COC(n3cnc4c(N[Tl])ncnc43)CC2O1.CO |
| InChI | InChI=1S/C13H16N5O3.C2H6.CH4O.Tl/c1-13(2)20-7-3-9(19-4-8(7)21-13)18-6-17-10-11(14)15-5-16-12(10)18;2*1-2;/h5-9H,3-4H2,1-2H3,(H-,14,15,16);1-2H3;2H,1H3;/q-1;;;+1 |
| InChIKey | ZVDQJTUCGCOSAH-UHFFFAOYSA-N |
| XLogP | 1.40 |
| TPSA | 103.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.80 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |