C15H22IrN5O3- — CID 167508913
[9-(2,2-dimethyl-4,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]pyran-6-yl)purin-6-yl]azanide;ethane;iridium (PubChem CID 167508913) has the molecular formula C15H22IrN5O3- and a molecular weight of 512.59 g/mol. Its IUPAC name is [9-(2,2-dimethyl-4,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]pyran-6-yl)purin-6-yl]azanide;ethane;iridium.
| Compound Name | [9-(2,2-dimethyl-4,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]pyran-6-yl)purin-6-yl]azanide;ethane;iridium |
|---|---|
| PubChem CID | 167508913 |
| Molecular Formula | C15H22IrN5O3- |
| Molecular Weight | 512.59 g/mol |
| Exact Mass | 513.14 |
| IUPAC Name | [9-(2,2-dimethyl-4,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]pyran-6-yl)purin-6-yl]azanide;ethane;iridium |
| SMILES | CC.CC1(C)OC2COC(n3cnc4c([NH-])ncnc43)CC2O1.[Ir] |
| InChI | InChI=1S/C13H16N5O3.C2H6.Ir/c1-13(2)20-7-3-9(19-4-8(7)21-13)18-6-17-10-11(14)15-5-16-12(10)18;1-2;/h5-9H,3-4H2,1-2H3,(H-,14,15,16);1-2H3;/q-1;; |
| InChIKey | VXODQCBDKOJPOM-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 95.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.59 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |