C14H19N5O3 — CID 102516834
9-[(4aS,7R,8aR)-2,2-dimethyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-7-yl]purin-6-amine (PubChem CID 102516834) has the molecular formula C14H19N5O3 and a molecular weight of 305.34 g/mol. Its IUPAC name is 9-[(4aS,7R,8aR)-2,2-dimethyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-7-yl]purin-6-amine.
| Compound Name | 9-[(4aS,7R,8aR)-2,2-dimethyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-7-yl]purin-6-amine |
|---|---|
| PubChem CID | 102516834 |
| Molecular Formula | C14H19N5O3 |
| Molecular Weight | 305.34 g/mol |
| Exact Mass | 305.15 |
| IUPAC Name | 9-[(4aS,7R,8aR)-2,2-dimethyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-7-yl]purin-6-amine |
| SMILES | CC1(C)OC[C@@H]2OC[C@H](n3cnc4c(N)ncnc43)C[C@H]2O1 |
| InChI | InChI=1S/C14H19N5O3/c1-14(2)21-5-10-9(22-14)3-8(4-20-10)19-7-18-11-12(15)16-6-17-13(11)19/h6-10H,3-5H2,1-2H3,(H2,15,16,17)/t8-,9-,10+/m1/s1 |
| InChIKey | PWNVNOJTQASZIK-BBBLOLIVSA-N |
| XLogP | 0.89 |
| TPSA | 97.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.34 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |