C16H24N6O2 — CID 170394659
9-[(3aR,4R,6R,6aS)-6-(ethylaminomethyl)-2,2-dimethyl-4,5,6,6a-tetrahydro-3aH-cyclopenta[d][1,3]dioxol-4-yl]purin-6-amine (PubChem CID 170394659) has the molecular formula C16H24N6O2 and a molecular weight of 332.41 g/mol. Its IUPAC name is 9-[(3aR,4R,6R,6aS)-6-(ethylaminomethyl)-2,2-dimethyl-4,5,6,6a-tetrahydro-3aH-cyclopenta[d][1,3]dioxol-4-yl]purin-6-amine.
| Compound Name | 9-[(3aR,4R,6R,6aS)-6-(ethylaminomethyl)-2,2-dimethyl-4,5,6,6a-tetrahydro-3aH-cyclopenta[d][1,3]dioxol-4-yl]purin-6-amine |
|---|---|
| PubChem CID | 170394659 |
| Molecular Formula | C16H24N6O2 |
| Molecular Weight | 332.41 g/mol |
| Exact Mass | 332.20 |
| IUPAC Name | 9-[(3aR,4R,6R,6aS)-6-(ethylaminomethyl)-2,2-dimethyl-4,5,6,6a-tetrahydro-3aH-cyclopenta[d][1,3]dioxol-4-yl]purin-6-amine |
| SMILES | CCNC[C@H]1C[C@@H](n2cnc3c(N)ncnc32)[C@H]2OC(C)(C)O[C@@H]12 |
| InChI | InChI=1S/C16H24N6O2/c1-4-18-6-9-5-10(13-12(9)23-16(2,3)24-13)22-8-21-11-14(17)19-7-20-15(11)22/h7-10,12-13,18H,4-6H2,1-3H3,(H2,17,19,20)/t9-,10-,12+,13-/m1/s1 |
| InChIKey | VEFHVOWGONBTOO-VCDKRKBESA-N |
| XLogP | 1.10 |
| TPSA | 100.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.41 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |