C16H21IN4O3 — CID 89391028
9-[(3aS,4R,6R,6aR)-6-(methoxymethyl)-2,2-dimethyl-4,5,6,6a-tetrahydro-3aH-cyclopenta[d][1,3]dioxol-4-yl]-6-(iodomethyl)purine (PubChem CID 89391028) has the molecular formula C16H21IN4O3 and a molecular weight of 444.27 g/mol. Its IUPAC name is 9-[(3aS,4R,6R,6aR)-6-(methoxymethyl)-2,2-dimethyl-4,5,6,6a-tetrahydro-3aH-cyclopenta[d][1,3]dioxol-4-yl]-6-(iodomethyl)purine.
| Compound Name | 9-[(3aS,4R,6R,6aR)-6-(methoxymethyl)-2,2-dimethyl-4,5,6,6a-tetrahydro-3aH-cyclopenta[d][1,3]dioxol-4-yl]-6-(iodomethyl)purine |
|---|---|
| PubChem CID | 89391028 |
| Molecular Formula | C16H21IN4O3 |
| Molecular Weight | 444.27 g/mol |
| Exact Mass | 444.07 |
| IUPAC Name | 9-[(3aS,4R,6R,6aR)-6-(methoxymethyl)-2,2-dimethyl-4,5,6,6a-tetrahydro-3aH-cyclopenta[d][1,3]dioxol-4-yl]-6-(iodomethyl)purine |
| SMILES | COC[C@H]1C[C@@H](n2cnc3c(CI)ncnc32)[C@@H]2OC(C)(C)O[C@H]12 |
| InChI | InChI=1S/C16H21IN4O3/c1-16(2)23-13-9(6-22-3)4-11(14(13)24-16)21-8-20-12-10(5-17)18-7-19-15(12)21/h7-9,11,13-14H,4-6H2,1-3H3/t9-,11-,13-,14+/m1/s1 |
| InChIKey | LCVVBPZNHSSGAG-IMJCEVDSSA-N |
| XLogP | 2.49 |
| TPSA | 71.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.27 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|