C17H25N4O7P — CID 10717404
[(3aR,4S,6R,6aS)-6-(6-methoxypurin-9-yl)-2,2-dimethyl-4,5,6,6a-tetrahydro-3aH-cyclopenta[d][1,3]dioxol-4-yl]oxymethyl-ethoxyphosphinic acid (PubChem CID 10717404) has the molecular formula C17H25N4O7P and a molecular weight of 428.38 g/mol. Its IUPAC name is [(3aR,4S,6R,6aS)-6-(6-methoxypurin-9-yl)-2,2-dimethyl-4,5,6,6a-tetrahydro-3aH-cyclopenta[d][1,3]dioxol-4-yl]oxymethyl-ethoxyphosphinic acid.
| Compound Name | [(3aR,4S,6R,6aS)-6-(6-methoxypurin-9-yl)-2,2-dimethyl-4,5,6,6a-tetrahydro-3aH-cyclopenta[d][1,3]dioxol-4-yl]oxymethyl-ethoxyphosphinic acid |
|---|---|
| PubChem CID | 10717404 |
| Molecular Formula | C17H25N4O7P |
| Molecular Weight | 428.38 g/mol |
| Exact Mass | 428.15 |
| IUPAC Name | [(3aR,4S,6R,6aS)-6-(6-methoxypurin-9-yl)-2,2-dimethyl-4,5,6,6a-tetrahydro-3aH-cyclopenta[d][1,3]dioxol-4-yl]oxymethyl-ethoxyphosphinic acid |
| SMILES | CCOP(=O)(O)CO[C@H]1C[C@@H](n2cnc3c(OC)ncnc32)[C@@H]2OC(C)(C)O[C@@H]21 |
| InChI | InChI=1S/C17H25N4O7P/c1-5-26-29(22,23)9-25-11-6-10(13-14(11)28-17(2,3)27-13)21-8-20-12-15(21)18-7-19-16(12)24-4/h7-8,10-11,13-14H,5-6,9H2,1-4H3,(H,22,23)/t10-,11+,13+,14-/m1/s1 |
| InChIKey | UWEPMCKXTBQGGZ-UVLXDEKHSA-N |
| XLogP | 1.86 |
| TPSA | 127.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.38 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|