C15H22ClN4O5P — CID 10835091
(1S,2S,4S)-4-(6-chloropurin-9-yl)-2-(diethoxyphosphorylmethoxy)cyclopentan-1-ol (PubChem CID 10835091) has the molecular formula C15H22ClN4O5P and a molecular weight of 404.79 g/mol. Its IUPAC name is (1S,2S,4S)-4-(6-chloropurin-9-yl)-2-(diethoxyphosphorylmethoxy)cyclopentan-1-ol.
| Compound Name | (1S,2S,4S)-4-(6-chloropurin-9-yl)-2-(diethoxyphosphorylmethoxy)cyclopentan-1-ol |
|---|---|
| PubChem CID | 10835091 |
| Molecular Formula | C15H22ClN4O5P |
| Molecular Weight | 404.79 g/mol |
| Exact Mass | 404.10 |
| IUPAC Name | (1S,2S,4S)-4-(6-chloropurin-9-yl)-2-(diethoxyphosphorylmethoxy)cyclopentan-1-ol |
| SMILES | CCOP(=O)(CO[C@H]1C[C@@H](n2cnc3c(Cl)ncnc32)C[C@@H]1O)OCC |
| InChI | InChI=1S/C15H22ClN4O5P/c1-3-24-26(22,25-4-2)9-23-12-6-10(5-11(12)21)20-8-19-13-14(16)17-7-18-15(13)20/h7-8,10-12,21H,3-6,9H2,1-2H3/t10-,11-,12-/m0/s1 |
| InChIKey | IHEBBYGOIVUBEF-SRVKXCTJSA-N |
| XLogP | 2.78 |
| TPSA | 108.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.79 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|