C21H35ClN4OSi — CID 159359979
[(1S,2S,4R)-4-(6-chloropurin-9-yl)-2-ethylcyclopentyl]oxy-tri(propan-2-yl)silane (PubChem CID 159359979) has the molecular formula C21H35ClN4OSi and a molecular weight of 423.08 g/mol. Its IUPAC name is [(1S,2S,4R)-4-(6-chloropurin-9-yl)-2-ethylcyclopentyl]oxy-tri(propan-2-yl)silane.
| Compound Name | [(1S,2S,4R)-4-(6-chloropurin-9-yl)-2-ethylcyclopentyl]oxy-tri(propan-2-yl)silane |
|---|---|
| PubChem CID | 159359979 |
| Molecular Formula | C21H35ClN4OSi |
| Molecular Weight | 423.08 g/mol |
| Exact Mass | 422.23 |
| IUPAC Name | [(1S,2S,4R)-4-(6-chloropurin-9-yl)-2-ethylcyclopentyl]oxy-tri(propan-2-yl)silane |
| SMILES | CC[C@H]1C[C@@H](n2cnc3c(Cl)ncnc32)C[C@@H]1O[Si](C(C)C)(C(C)C)C(C)C |
| InChI | InChI=1S/C21H35ClN4OSi/c1-8-16-9-17(26-12-25-19-20(22)23-11-24-21(19)26)10-18(16)27-28(13(2)3,14(4)5)15(6)7/h11-18H,8-10H2,1-7H3/t16-,17+,18-/m0/s1 |
| InChIKey | WDXASWXYGBENQF-KSZLIROESA-N |
| XLogP | 6.40 |
| TPSA | 52.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.08 |
| LogP ≤ 5 | 6.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|