C20H35N5OSi — CID 66739366
9-[3-[1-tri(propan-2-yl)silyloxyethyl]cyclobutyl]purin-6-amine (PubChem CID 66739366) has the molecular formula C20H35N5OSi and a molecular weight of 389.62 g/mol. Its IUPAC name is 9-[3-[1-tri(propan-2-yl)silyloxyethyl]cyclobutyl]purin-6-amine.
| Compound Name | 9-[3-[1-tri(propan-2-yl)silyloxyethyl]cyclobutyl]purin-6-amine |
|---|---|
| PubChem CID | 66739366 |
| Molecular Formula | C20H35N5OSi |
| Molecular Weight | 389.62 g/mol |
| Exact Mass | 389.26 |
| IUPAC Name | 9-[3-[1-tri(propan-2-yl)silyloxyethyl]cyclobutyl]purin-6-amine |
| SMILES | CC(O[Si](C(C)C)(C(C)C)C(C)C)C1CC(n2cnc3c(N)ncnc32)C1 |
| InChI | InChI=1S/C20H35N5OSi/c1-12(2)27(13(3)4,14(5)6)26-15(7)16-8-17(9-16)25-11-24-18-19(21)22-10-23-20(18)25/h10-17H,8-9H2,1-7H3,(H2,21,22,23) |
| InChIKey | XBBCEGLBZUWWLO-UHFFFAOYSA-N |
| XLogP | 4.94 |
| TPSA | 78.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.62 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|