C20H35N5O3Si2 — CID 67078091
CID 67078091 (PubChem CID 67078091) has the molecular formula C20H35N5O3Si2 and a molecular weight of 449.70 g/mol.
| Compound Name | CID 67078091 |
|---|---|
| PubChem CID | 67078091 |
| Molecular Formula | C20H35N5O3Si2 |
| Molecular Weight | 449.70 g/mol |
| Exact Mass | 449.23 |
| IUPAC Name | — |
| SMILES | CC(C)[Si]OC(C)(C)C1OC(n2cnc3c(N)ncnc32)CC1O[Si](C)(C)C(C)C |
| InChI | InChI=1S/C20H35N5O3Si2/c1-12(2)29-28-20(5,6)17-14(27-30(7,8)13(3)4)9-15(26-17)25-11-24-16-18(21)22-10-23-19(16)25/h10-15,17H,9H2,1-8H3,(H2,21,22,23) |
| InChIKey | CGMFWQLCLBQTCD-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 97.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.70 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|