C13H17N5O5 — CID 123507225
5-(6-aminopurin-9-yl)-3-(2-hydroxypropan-2-yloxy)oxolane-2-carboxylic acid (PubChem CID 123507225) has the molecular formula C13H17N5O5 and a molecular weight of 323.31 g/mol. Its IUPAC name is 5-(6-aminopurin-9-yl)-3-(2-hydroxypropan-2-yloxy)oxolane-2-carboxylic acid.
| Compound Name | 5-(6-aminopurin-9-yl)-3-(2-hydroxypropan-2-yloxy)oxolane-2-carboxylic acid |
|---|---|
| PubChem CID | 123507225 |
| Molecular Formula | C13H17N5O5 |
| Molecular Weight | 323.31 g/mol |
| Exact Mass | 323.12 |
| IUPAC Name | 5-(6-aminopurin-9-yl)-3-(2-hydroxypropan-2-yloxy)oxolane-2-carboxylic acid |
| SMILES | CC(C)(O)OC1CC(n2cnc3c(N)ncnc32)OC1C(=O)O |
| InChI | InChI=1S/C13H17N5O5/c1-13(2,21)23-6-3-7(22-9(6)12(19)20)18-5-17-8-10(14)15-4-16-11(8)18/h4-7,9,21H,3H2,1-2H3,(H,19,20)(H2,14,15,16) |
| InChIKey | YNLHPFQKCDFLJM-UHFFFAOYSA-N |
| XLogP | -0.11 |
| TPSA | 145.61 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.31 |
| LogP ≤ 5 | -0.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|