C12H14Br3N5O2 — CID 67640585
9-[(2R,5R)-5-methyl-4-(2,2,2-tribromoethoxy)oxolan-2-yl]purin-6-amine (PubChem CID 67640585) has the molecular formula C12H14Br3N5O2 and a molecular weight of 499.99 g/mol. Its IUPAC name is 9-[(2R,5R)-5-methyl-4-(2,2,2-tribromoethoxy)oxolan-2-yl]purin-6-amine.
| Compound Name | 9-[(2R,5R)-5-methyl-4-(2,2,2-tribromoethoxy)oxolan-2-yl]purin-6-amine |
|---|---|
| PubChem CID | 67640585 |
| Molecular Formula | C12H14Br3N5O2 |
| Molecular Weight | 499.99 g/mol |
| Exact Mass | 496.87 |
| IUPAC Name | 9-[(2R,5R)-5-methyl-4-(2,2,2-tribromoethoxy)oxolan-2-yl]purin-6-amine |
| SMILES | C[C@H]1O[C@@H](n2cnc3c(N)ncnc32)CC1OCC(Br)(Br)Br |
| InChI | InChI=1S/C12H14Br3N5O2/c1-6-7(21-3-12(13,14)15)2-8(22-6)20-5-19-9-10(16)17-4-18-11(9)20/h4-8H,2-3H2,1H3,(H2,16,17,18)/t6-,7?,8-/m1/s1 |
| InChIKey | XOEAQDKZSAPAOT-OECOWPMFSA-N |
| XLogP | 2.94 |
| TPSA | 88.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.99 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|