C20H26N6O3 — CID 173380354
2-[(2R,3S)-5-(6-aminopurin-9-yl)-2-[(benzylamino)methyl]oxolan-3-yl]oxypropan-2-ol (PubChem CID 173380354) has the molecular formula C20H26N6O3 and a molecular weight of 398.47 g/mol. Its IUPAC name is 2-[(2R,3S)-5-(6-aminopurin-9-yl)-2-[(benzylamino)methyl]oxolan-3-yl]oxypropan-2-ol.
| Compound Name | 2-[(2R,3S)-5-(6-aminopurin-9-yl)-2-[(benzylamino)methyl]oxolan-3-yl]oxypropan-2-ol |
|---|---|
| PubChem CID | 173380354 |
| Molecular Formula | C20H26N6O3 |
| Molecular Weight | 398.47 g/mol |
| Exact Mass | 398.21 |
| IUPAC Name | 2-[(2R,3S)-5-(6-aminopurin-9-yl)-2-[(benzylamino)methyl]oxolan-3-yl]oxypropan-2-ol |
| SMILES | CC(C)(O)O[C@H]1CC(n2cnc3c(N)ncnc32)O[C@@H]1CNCc1ccccc1 |
| InChI | InChI=1S/C20H26N6O3/c1-20(2,27)29-14-8-16(26-12-25-17-18(21)23-11-24-19(17)26)28-15(14)10-22-9-13-6-4-3-5-7-13/h3-7,11-12,14-16,22,27H,8-10H2,1-2H3,(H2,21,23,24)/t14-,15+,16?/m0/s1 |
| InChIKey | HPNMLVWGUYSEEU-QMRHZFGWSA-N |
| XLogP | 1.60 |
| TPSA | 120.34 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.47 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|