C11H13IN5- — CID 149235601
9-(4-methyliodanuidylcyclopent-2-en-1-yl)purin-6-amine (PubChem CID 149235601) has the molecular formula C11H13IN5- and a molecular weight of 342.16 g/mol. Its IUPAC name is 9-(4-methyliodanuidylcyclopent-2-en-1-yl)purin-6-amine.
| Compound Name | 9-(4-methyliodanuidylcyclopent-2-en-1-yl)purin-6-amine |
|---|---|
| PubChem CID | 149235601 |
| Molecular Formula | C11H13IN5- |
| Molecular Weight | 342.16 g/mol |
| Exact Mass | 342.02 |
| IUPAC Name | 9-(4-methyliodanuidylcyclopent-2-en-1-yl)purin-6-amine |
| SMILES | C[I-]C1C=CC(n2cnc3c(N)ncnc32)C1 |
| InChI | InChI=1S/C11H13IN5/c1-12-7-2-3-8(4-7)17-6-16-9-10(13)14-5-15-11(9)17/h2-3,5-8H,4H2,1H3,(H2,13,14,15)/q-1 |
| InChIKey | BCHUOGNSKYYUAN-UHFFFAOYSA-N |
| XLogP | -2.00 |
| TPSA | 69.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.16 |
| LogP ≤ 5 | -2.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|