C12H13N5O3 — CID 20779328
2-[4-(6-aminopurin-9-yl)cyclopent-2-en-1-yl]oxyacetic acid (PubChem CID 20779328) has the molecular formula C12H13N5O3 and a molecular weight of 275.27 g/mol. Its IUPAC name is 2-[4-(6-aminopurin-9-yl)cyclopent-2-en-1-yl]oxyacetic acid.
| Compound Name | 2-[4-(6-aminopurin-9-yl)cyclopent-2-en-1-yl]oxyacetic acid |
|---|---|
| PubChem CID | 20779328 |
| Molecular Formula | C12H13N5O3 |
| Molecular Weight | 275.27 g/mol |
| Exact Mass | 275.10 |
| IUPAC Name | 2-[4-(6-aminopurin-9-yl)cyclopent-2-en-1-yl]oxyacetic acid |
| SMILES | Nc1ncnc2c1ncn2C1C=CC(OCC(=O)O)C1 |
| InChI | InChI=1S/C12H13N5O3/c13-11-10-12(15-5-14-11)17(6-16-10)7-1-2-8(3-7)20-4-9(18)19/h1-2,5-8H,3-4H2,(H,18,19)(H2,13,14,15) |
| InChIKey | CMJHWUKNQLPVPV-UHFFFAOYSA-N |
| XLogP | 0.38 |
| TPSA | 116.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.27 |
| LogP ≤ 5 | 0.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|