C11H10N6 — CID 22985708
4-(6-aminopurin-9-yl)cyclopent-2-ene-1-carbonitrile (PubChem CID 22985708) has the molecular formula C11H10N6 and a molecular weight of 226.24 g/mol. Its IUPAC name is 4-(6-aminopurin-9-yl)cyclopent-2-ene-1-carbonitrile.
| Compound Name | 4-(6-aminopurin-9-yl)cyclopent-2-ene-1-carbonitrile |
|---|---|
| PubChem CID | 22985708 |
| Molecular Formula | C11H10N6 |
| Molecular Weight | 226.24 g/mol |
| Exact Mass | 226.10 |
| IUPAC Name | 4-(6-aminopurin-9-yl)cyclopent-2-ene-1-carbonitrile |
| SMILES | N#CC1C=CC(n2cnc3c(N)ncnc32)C1 |
| InChI | InChI=1S/C11H10N6/c12-4-7-1-2-8(3-7)17-6-16-9-10(13)14-5-15-11(9)17/h1-2,5-8H,3H2,(H2,13,14,15) |
| InChIKey | ISYZTKBOKUIQRH-UHFFFAOYSA-N |
| XLogP | 1.05 |
| TPSA | 93.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.24 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|