C15H18FN5OSi — CID 145339378
(1R,4R)-4-(6-aminopurin-9-yl)-2-fluoro-1-(2-trimethylsilylethynyl)cyclopent-2-en-1-ol (PubChem CID 145339378) has the molecular formula C15H18FN5OSi and a molecular weight of 331.43 g/mol. Its IUPAC name is (1R,4R)-4-(6-aminopurin-9-yl)-2-fluoro-1-(2-trimethylsilylethynyl)cyclopent-2-en-1-ol.
| Compound Name | (1R,4R)-4-(6-aminopurin-9-yl)-2-fluoro-1-(2-trimethylsilylethynyl)cyclopent-2-en-1-ol |
|---|---|
| PubChem CID | 145339378 |
| Molecular Formula | C15H18FN5OSi |
| Molecular Weight | 331.43 g/mol |
| Exact Mass | 331.13 |
| IUPAC Name | (1R,4R)-4-(6-aminopurin-9-yl)-2-fluoro-1-(2-trimethylsilylethynyl)cyclopent-2-en-1-ol |
| SMILES | C[Si](C)(C)C#C[C@]1(O)C[C@@H](n2cnc3c(N)ncnc32)C=C1F |
| InChI | InChI=1S/C15H18FN5OSi/c1-23(2,3)5-4-15(22)7-10(6-11(15)16)21-9-20-12-13(17)18-8-19-14(12)21/h6,8-10,22H,7H2,1-3H3,(H2,17,18,19)/t10-,15-/m0/s1 |
| InChIKey | DQMZEZRNMQPYTM-BONVTDFDSA-N |
| XLogP | 1.82 |
| TPSA | 89.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.43 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|